What are the skeletal structure of the the following? 1.(CH3)2CHCH2CH2CH(CH3)2 2.CH3CH(Cl)CH(OH)CH3 3. (CH3)3C(CH2)4CH2CH3 4. C5H5N 5. Limonene 6. CH3(CH2)2C(CH3)2CH(CH3)CH(CH3)CH(Br)CH3 Please I really need this one. Thank you

1 Answer
Write your answer here...
Start with a one sentence answer
Then teach the underlying concepts
Don't copy without citing sources
preview
?

Answer

Write a one sentence answer...

Answer:

Explanation

Explain in detail...

Explanation:

I want someone to double check my answer

Describe your changes (optional) 200

1
dk_ch Share
Jan 27, 2017

1.
upload.wikimedia.org

2,5-dimethylhexane

~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
2.
drawn

~~~~~~~~~~-~~~~~~~~~~~~~~~~~~~~~~~
3.
www.clearsynth.com

2,2-dimethyloctane
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~

4.
www.sigmaaldrich.com

Pyridine

~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~

5.

www.gbpuat-cbsh.ac.in

Limonene

~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
6.
enter image source here

(structure will be later)

Was this helpful? Let the contributor know!
1500